Products 285979-70-6
CAS 285979-70-6 appears in our catalog under these names: Choline-d4 Chloride, >95% (HPLC), Choline-1,1,2,2-d4 Chloride, 98 atom % D, min 98% Chemical Purity, Choline-d4 Chloride, Choline–d4 chloride, Choline-d4 (chloride), 99.90%. Offered by: TRC, CDN, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 0,25g, 0,1g, 1mg, 5mg, 1 mg.
Trimethyl-(1,1,2,2-tetradeuterio-2-hydroxyethyl)azanium chloride (CAS 285979-70-6) is a chemical compound with the molecular formula C5H14ClNO and a molecular weight of 143.65 g/mol. IUPAC name: trimethyl-(1,1,2,2-tetradeuterio-2-hydroxyethyl)azanium chloride. InChIKey: SGMZJAMFUVOLNK-HGFPCDIYSA-M.
| Molecular formula | C5H14ClNO |
|---|---|
| Molecular weight | 143.65 g/mol |
| IUPAC name | trimethyl-(1,1,2,2-tetradeuterio-2-hydroxyethyl)azanium chloride |
| InChIKey | SGMZJAMFUVOLNK-HGFPCDIYSA-M |
| SMILES | [2H]C([2H])(C([2H])([2H])O)[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
choline-d4 chloride, Choline-d4 (chloride), trimethyl-(1,1,2,2-tetradeuterio-2-hydroxyethyl)azanium;chloride, orb2280987, Choline chloride-1,1,2,2-d4, 98 atom % D, [2-hydroxy(1,1,2,2-?H?)ethyl]trimethylazanium chloride, 2-Hydroxy-N,N,N-trimethylethan-1,1,2,2-d4-aminium chloride, trimethyl-(1,1,2,2-tetradeuterio-2-hydroxy-ethyl)ammonium;chloride