Products 61037-86-3
CAS 61037-86-3 appears in our catalog under these names: Choline-d9 Chloride, Choline-d9 Chloride, >95% (HPLC), Choline-d9 Chloride (N,N,N-trimethyl-d9), 98 atom % D, min 98% Chemical Purity, Choline–d9 (chloride), CHOLINE CHLORIDE-TRIMETHYL-D9, 98 ATOM. Offered by: Chemat Brand, TRC, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: on request, 100mg, 10mg, 1g, 0,5g, 500mg, 50 mg, 100 mg.
2-hydroxyethyl-tris(trideuteriomethyl)azanium chloride (CAS 61037-86-3) is a chemical compound with the molecular formula C5H14ClNO and a molecular weight of 148.68 g/mol. IUPAC name: 2-hydroxyethyl-tris(trideuteriomethyl)azanium chloride. InChIKey: SGMZJAMFUVOLNK-KYRNGWDOSA-M.
| Molecular formula | C5H14ClNO |
|---|---|
| Molecular weight | 148.68 g/mol |
| IUPAC name | 2-hydroxyethyl-tris(trideuteriomethyl)azanium chloride |
| InChIKey | SGMZJAMFUVOLNK-KYRNGWDOSA-M |
| SMILES | [2H]C([2H])([2H])[N+](CCO)(C([2H])([2H])[2H])C([2H])([2H])[2H].[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
Choline chloride-trimethyl-d9, Choline-d9 Chloride, Methyl-D9-choline chloride, Choline-d9 (chloride), Choline chloride-(trimethyl-d9), Choline-2H9 chloride, Choline-d9 Chloride (N,N,N-trimethyl-d9), Choline-tri(methyl-d3), chloride, 2-hydroxyethyl-tris(trideuteriomethyl)azanium;chloride, orb3027379