CAS 202264-66-2 appears in our catalog under these names: Methyl 2,4–Dimethyl–5–Nitrobenzoate, Methyl 2,4-dimethyl-5-nitrobenzoate, Methyl 2,4-dimethyl-5-nitrobenzoate 98%, Methyl 2,4-dimethyl-5-nitrobenzoate, 98%, 98%, METHYL 2,4-DIMETHYL-5-NITROBENZOATE, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg, 10g, 500mg, 2.5g.
Methyl 2,4-dimethyl-5-nitrobenzoate (CAS 202264-66-2) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: methyl 2,4-dimethyl-5-nitrobenzoate. InChIKey: QAORUQFQPFOSBF-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | methyl 2,4-dimethyl-5-nitrobenzoate |
| InChIKey | QAORUQFQPFOSBF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)OC)[N+](=O)[O-])C |
Computed by PubChem (NCBI)