CAS 20232-39-7 appears in our catalog under these names: Tetrabenazine Impurity 5, 6,7-Dimethoxy-3,4-dihydroisoquinoline Hydrochloride Hydrate, 6,7–Dimethoxy–3,4–dihydroisoquinoline Hydrochloride, 6,7-Dimethoxy-3,4-dihydroisoquinoline Hydrochloride, >98.0%(HPLC)(T), 6,7-Dimethoxy-3,4-dihydroisoquinoline hydrochloride hydrate, 99+%. Offered by: Chemat Brand, TRC, GLPBio, TCI, Thermo Scientific (Acros). Available pack sizes: on request, 10g, 25g, 5g, 1g, 100g, 500g.
6,7-dimethoxy-3,4-dihydroisoquinoline;hydrochloride (CAS 20232-39-7) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: 6,7-dimethoxy-3,4-dihydroisoquinoline;hydrochloride. InChIKey: PQXVEYYRJHMTEV-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 6,7-dimethoxy-3,4-dihydroisoquinoline;hydrochloride |
| InChIKey | PQXVEYYRJHMTEV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C=NCCC2=C1)OC.Cl |
Computed by PubChem (NCBI)