Products 202396-52-9
CAS 202396-52-9 is the registry number for 6-chloro-2-(chloromethyl)-1,3-benzoxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-chloro-2-(chloromethyl)-1,3-benzoxazole (CAS 202396-52-9) is a chemical compound with the molecular formula C8H5Cl2NO and a molecular weight of 202.03 g/mol. IUPAC name: 6-chloro-2-(chloromethyl)-1,3-benzoxazole. InChIKey: LWFVLQNVCIBMRB-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO |
|---|---|
| Molecular weight | 202.03 g/mol |
| IUPAC name | 6-chloro-2-(chloromethyl)-1,3-benzoxazole |
| InChIKey | LWFVLQNVCIBMRB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)OC(=N2)CCl |
Computed by PubChem (NCBI)