CAS 30482-87-2 appears in our catalog under these names: 2,6-Dichloro-4-methoxybenzonitrile, 95%, 2,6–Dichloro–4–methoxybenzonitrile, 2,6-Dichloro-4-methoxybenzonitrile 95%, 2,6-Dichloro-4-methoxybenzonitrile, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g.
2,6-dichloro-4-methoxybenzonitrile (CAS 30482-87-2) is a chemical compound with the molecular formula C8H5Cl2NO and a molecular weight of 202.03 g/mol. IUPAC name: 2,6-dichloro-4-methoxybenzonitrile. InChIKey: MTKOPGRUFMDVSS-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO |
|---|---|
| Molecular weight | 202.03 g/mol |
| IUPAC name | 2,6-dichloro-4-methoxybenzonitrile |
| InChIKey | MTKOPGRUFMDVSS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Cl)C#N)Cl |
Computed by PubChem (NCBI)