Products 71293-59-9
CAS 71293-59-9 appears in our catalog under these names: 5,6-Dichloroindolin-2-one, 95%, 5,6-Dichloroindolin-2-one 98%, 5,6-Dichloroindolin-2-One, 98%, 98%, 5,6-Dichloroindolin-2-one, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g, 250mg.
5,6-dichloro-1,3-dihydroindol-2-one (CAS 71293-59-9) is a chemical compound with the molecular formula C8H5Cl2NO and a molecular weight of 202.03 g/mol. IUPAC name: 5,6-dichloro-1,3-dihydroindol-2-one. InChIKey: ADDAYZCZQHOPJX-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO |
|---|---|
| Molecular weight | 202.03 g/mol |
| IUPAC name | 5,6-dichloro-1,3-dihydroindol-2-one |
| InChIKey | ADDAYZCZQHOPJX-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2NC1=O)Cl)Cl |
Computed by PubChem (NCBI)