CAS 93842-97-8 appears in our catalog under these names: 2-(2,3-Dichlorophenyl)-2-hydroxyacetonitrile, 95%, 2–(2,3–Dichlorophenyl)–2–hydroxyacetonitrile. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-(2,3-dichlorophenyl)-2-hydroxyacetonitrile (CAS 93842-97-8) is a chemical compound with the molecular formula C8H5Cl2NO and a molecular weight of 202.03 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)-2-hydroxyacetonitrile. InChIKey: VMBJRKFGAMINPT-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO |
|---|---|
| Molecular weight | 202.03 g/mol |
| IUPAC name | 2-(2,3-dichlorophenyl)-2-hydroxyacetonitrile |
| InChIKey | VMBJRKFGAMINPT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(C#N)O |
Computed by PubChem (NCBI)