CAS 19752-09-1 appears in our catalog under these names: 3,4-Dichlorobenzyl isocyanate, 95%, 3,4-Dichlorobenzyl isocyanate, 98%, 3,4-Dichlorobenzylisocyanate 95%. Offered by: Combi-blocks, Thermo Scientific (Acros), Ambeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1,2-dichloro-4-(isocyanatomethyl)benzene (CAS 19752-09-1) is a chemical compound with the molecular formula C8H5Cl2NO and a molecular weight of 202.03 g/mol. IUPAC name: 1,2-dichloro-4-(isocyanatomethyl)benzene. InChIKey: WLNAHQZFPSSVTP-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO |
|---|---|
| Molecular weight | 202.03 g/mol |
| IUPAC name | 1,2-dichloro-4-(isocyanatomethyl)benzene |
| InChIKey | WLNAHQZFPSSVTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CN=C=O)Cl)Cl |
Computed by PubChem (NCBI)