Products 202407-26-9
CAS 202407-26-9 appears in our catalog under these names: L-Tyrosine-13C9,15N, >95% (HPLC), L-Tyrosine-13C9,15N, L–Tyrosine–13C9,15N, L-TYROSINE-13C9,15N, 98 ATOM % 15N, 98 &, L-Tyrosine-¹³C₉,¹⁵N. Offered by: TRC, TargetMol, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 25mg, 5mg, 1mg, 10mg, 250mg, 50mg, 10 mg.
(2S)-2-(15N)azanyl-3-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)(1,2,3-13C3)propanoic acid (CAS 202407-26-9) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 191.12 g/mol. IUPAC name: (2S)-2-(15N)azanyl-3-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)(1,2,3-13C3)propanoic acid. InChIKey: OUYCCCASQSFEME-CMLFETTRSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 191.12 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-3-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)(1,2,3-13C3)propanoic acid |
| InChIKey | OUYCCCASQSFEME-CMLFETTRSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH][13CH]=[13C]1[13CH2][13C@@H]([13C](=O)O)[15NH2])O |
Computed by PubChem (NCBI)
Synonyms:
L-Tyrosine-13C9,15N, L-4-Hydroxyphenylalanine-13C9,15N, DL-Tyrosine-13C9,15N, L-Tyrosine-13C915N, L-13C915N-Tyrosine, L-Tyrosine-13C9-15N, L-Tyrosine-13C9, 15N, orb1693784, L-Tyrosine-13C9,15N, 98 atom % 15N, 98 atom % 13C, 95% (CP), L-Tyrosine-13C9,15N, 98 atom % 13C, 98 atom % 15N, optical purity ee: 99% (L-)