Products 202407-34-9
CAS 202407-34-9 appears in our catalog under these names: L-Serine -13C3,15N, >95% (HPLC), L-Serine-¹³C₃,¹⁵N, L-Serine-13C3,15N, 99.9%. Offered by: TRC, Chemat, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 5mg, 5 mg, 25 mg, 10 mg.
(2S)-2-(15N)azanyl-3-hydroxy(1,2,3-13C3)propanoic acid (CAS 202407-34-9) is a chemical compound with the molecular formula C3H7NO3 and a molecular weight of 109.064 g/mol. IUPAC name: (2S)-2-(15N)azanyl-3-hydroxy(1,2,3-13C3)propanoic acid. InChIKey: MTCFGRXMJLQNBG-UVYXLFMMSA-N.
| Molecular formula | C3H7NO3 |
|---|---|
| Molecular weight | 109.064 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-3-hydroxy(1,2,3-13C3)propanoic acid |
| InChIKey | MTCFGRXMJLQNBG-UVYXLFMMSA-N |
| SMILES | [13CH2]([13C@@H]([13C](=O)O)[15NH2])O |
Computed by PubChem (NCBI)