Products 202468-52-8
CAS 202468-52-8 appears in our catalog under these names: Homovanillic acid–13C6,18O, Homovanillic acid-13C6,18O, 99.2%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg.
2-(3-methoxy-4-(18O)oxidanyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)acetic acid (CAS 202468-52-8) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 190.13 g/mol. IUPAC name: 2-(3-methoxy-4-(18O)oxidanyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)acetic acid. InChIKey: QRMZSPFSDQBLIX-MCEPFFJHSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 190.13 g/mol |
| IUPAC name | 2-(3-methoxy-4-(18O)oxidanyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)acetic acid |
| InChIKey | QRMZSPFSDQBLIX-MCEPFFJHSA-N |
| SMILES | CO[13C]1=[13C]([13CH]=[13CH][13C](=[13CH]1)CC(=O)O)[18OH] |
Computed by PubChem (NCBI)