CAS 202599-73-3 appears in our catalog under these names: N-(Benzo(d)(1,3)dioxol-5-ylmethyl)-4-fluoroaniline, 95+%, N-(1,3-Dioxaindan-5-ylmethyl)-4-fluoroaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 250mg, 2,5g.
N-(1,3-benzodioxol-5-ylmethyl)-4-fluoroaniline (CAS 202599-73-3) is a chemical compound with the molecular formula C14H12FNO2 and a molecular weight of 245.25 g/mol. IUPAC name: N-(1,3-benzodioxol-5-ylmethyl)-4-fluoroaniline. InChIKey: UJLOFZRCJRQALK-UHFFFAOYSA-N.
| Molecular formula | C14H12FNO2 |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-ylmethyl)-4-fluoroaniline |
| InChIKey | UJLOFZRCJRQALK-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CNC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)