Products 20260-22-4
CAS 20260-22-4 appears in our catalog under these names: 2',5'-Dimethyl-1,1':4',1''-terphenyl 98%, 2',5'-Dimethyl-1,1':4',1''-terphenyl, 98%, 1,4-Dimethyl-2,5-diphenylbenzene, 98%, 2,5-Diphenyl-1,4-dimethylbenzene, 95-<97%, 2,5-Diphenyl-1,4-dimethylbenzene, ≥97-<99%. Offered by: Ambeed, Fluorochem, Combi-blocks, Hoffman Fine Chemicals, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 200g.
1,4-dimethyl-2,5-diphenylbenzene (CAS 20260-22-4) is a chemical compound with the molecular formula C20H18 and a molecular weight of 258.4 g/mol. IUPAC name: 1,4-dimethyl-2,5-diphenylbenzene. InChIKey: TUSIRMATSRRTEJ-UHFFFAOYSA-N.
| Molecular formula | C20H18 |
|---|---|
| Molecular weight | 258.4 g/mol |
| IUPAC name | 1,4-dimethyl-2,5-diphenylbenzene |
| InChIKey | TUSIRMATSRRTEJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C2=CC=CC=C2)C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)