CAS 796966-15-9 appears in our catalog under these names: (1R,4R)-2,5-Diphenylbicyclo[2.2.2]octa-2,5-diene 97%, (1R,4R)-2,5-diphenylbicyclo[2.2.2]Octa-2,5-diene, 97%, 97%, (1R,4R)-2,5-DIPHENYLBICYCLO[2.2.2]OCTA-2,5-DIENE, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1R,4R)-2,5-diphenylbicyclo[2.2.2]octa-2,5-diene (CAS 796966-15-9) is a chemical compound with the molecular formula C20H18 and a molecular weight of 258.4 g/mol. IUPAC name: (1R,4R)-2,5-diphenylbicyclo[2.2.2]octa-2,5-diene. InChIKey: BDYBOFJAEBJDMI-QZTJIDSGSA-N.
| Molecular formula | C20H18 |
|---|---|
| Molecular weight | 258.4 g/mol |
| IUPAC name | (1R,4R)-2,5-diphenylbicyclo[2.2.2]octa-2,5-diene |
| InChIKey | BDYBOFJAEBJDMI-QZTJIDSGSA-N |
| SMILES | C1C[C@@H]2C=C([C@H]1C=C2C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)