CAS 850409-83-5 appears in our catalog under these names: (1S,4S)-2,5-Diphenylbicyclo[2,2,2]octa-2,5-diene, 95%, (1S,4S)-2,5-Diphenylbicyclo[2.2.2]octa-2,5-diene 98%, (1S,4S)-2,5-DIPHENYLBICYCLO(2,2,2)OCTA-&, (1S,4S)-2,5-Diphenylbicyclo[2.2.2]octa-2,5-diene, 98%, 98%, (1S,4S)-2,5-diphenylbicyclo[2.2.2]Octa-2,5-diene, 98%. Offered by: Combi-blocks, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g, 500MG.
(1S,4S)-2,5-diphenylbicyclo[2.2.2]octa-2,5-diene (CAS 850409-83-5) is a chemical compound with the molecular formula C20H18 and a molecular weight of 258.4 g/mol. IUPAC name: (1S,4S)-2,5-diphenylbicyclo[2.2.2]octa-2,5-diene. InChIKey: BDYBOFJAEBJDMI-ROUUACIJSA-N.
| Molecular formula | C20H18 |
|---|---|
| Molecular weight | 258.4 g/mol |
| IUPAC name | (1S,4S)-2,5-diphenylbicyclo[2.2.2]octa-2,5-diene |
| InChIKey | BDYBOFJAEBJDMI-ROUUACIJSA-N |
| SMILES | C1C[C@H]2C=C([C@@H]1C=C2C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)