Products 78751-62-9
CAS 78751-62-9 is the registry number for 2-tert-butylpyrene, 98%. Offered by: Chemat. Available pack sizes: 250mg, 500mg, 1g.
2-tert-butylpyrene (CAS 78751-62-9) is a chemical compound with the molecular formula C20H18 and a molecular weight of 258.4 g/mol. IUPAC name: 2-tert-butylpyrene. InChIKey: AYMGBIYWAZRPJY-UHFFFAOYSA-N.
| Molecular formula | C20H18 |
|---|---|
| Molecular weight | 258.4 g/mol |
| IUPAC name | 2-tert-butylpyrene |
| InChIKey | AYMGBIYWAZRPJY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C3C(=C1)C=CC4=C3C(=CC=C4)C=C2 |
Computed by PubChem (NCBI)