CAS 3029-40-1 appears in our catalog under these names: Poly((9,9-dioctyl-2,7-fluorenylene)-co-(3,8-phenanthroline)) end capped with dimethylphenyl, (1E,3E,5E,7E)–1,8–Diphenylocta–1,3,5,7–tetraene. Offered by: Lumtec, GLPBio. Available pack sizes: On request, 1g.
[(1E,3E,5E,7E)-8-phenylocta-1,3,5,7-tetraenyl]benzene (CAS 3029-40-1) is a chemical compound with the molecular formula C20H18 and a molecular weight of 258.4 g/mol. IUPAC name: [(1E,3E,5E,7E)-8-phenylocta-1,3,5,7-tetraenyl]benzene. InChIKey: ZENGMMQJMCPHTK-FPPPDJHPSA-N.
| Molecular formula | C20H18 |
|---|---|
| Molecular weight | 258.4 g/mol |
| IUPAC name | [(1E,3E,5E,7E)-8-phenylocta-1,3,5,7-tetraenyl]benzene |
| InChIKey | ZENGMMQJMCPHTK-FPPPDJHPSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C=C/C=C/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)