Products 203302-97-0
CAS 203302-97-0 appears in our catalog under these names: 3-(Trifluoromethoxy)phenylacetic acid, 97%, 97%, 3–(Trifluoromethoxy)phenylacetic acid, 3-(Trifluoromethoxy)phenylacetic Acid, >95.0%(T), 3-(Trifluoromethoxy)phenylacetic acid, 98%. Offered by: Chemat, GLPBio, TCI, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g.
2-[3-(trifluoromethoxy)phenyl]acetic acid (CAS 203302-97-0) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 2-[3-(trifluoromethoxy)phenyl]acetic acid. InChIKey: NFZQVADYFXRRPM-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 2-[3-(trifluoromethoxy)phenyl]acetic acid |
| InChIKey | NFZQVADYFXRRPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(Trifluoromethoxy)phenylacetic Acid, 2-[3-(trifluoromethoxy)phenyl]acetic Acid, 3-Trifluoromethoxyphenylacetic acid, Benzeneacetic acid, 3-(trifluoromethoxy)-, 2-(3-(trifluoromethoxy)phenyl)acetic acid, 3-(trifluoromethoxy)-phenylacetic acid, [3-(trifluoromethoxy)phenyl]acetic acid, (3-trifluoromethoxyphenyl)acetic acid, 3-(Trifluoromethoxy)benzeneacetic acid, (3-trifluoromethoxy-phenyl)-acetic acid