CAS 203731-38-8 appears in our catalog under these names: 2,3-Dichloro-5-(methylsulfonyl)pyridine, 97%, 2,3-Dichloro-5-(methylsulfonyl)pyridine, 2,3-Dichloro-5-(methylsulfonyl)pyridine, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 0,5g, 50mg, 100mg, 250mg, 1g.
2,3-dichloro-5-methylsulfonylpyridine (CAS 203731-38-8) is a chemical compound with the molecular formula C6H5Cl2NO2S and a molecular weight of 226.08 g/mol. IUPAC name: 2,3-dichloro-5-methylsulfonylpyridine. InChIKey: CKEHZBXHXCACMG-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO2S |
|---|---|
| Molecular weight | 226.08 g/mol |
| IUPAC name | 2,3-dichloro-5-methylsulfonylpyridine |
| InChIKey | CKEHZBXHXCACMG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(N=C1)Cl)Cl |
Computed by PubChem (NCBI)