Products 203805-93-0
CAS 203805-93-0 is the registry number for Butyryl-L-carnitine-(N-methyl-d3). Offered by: Biosynth, Sigma-Aldrich. Available pack sizes: 2mg, 1mg, 5mg, 10mg, 25mg.
(3R)-3-butanoyloxy-4-[dimethyl(trideuteriomethyl)azaniumyl]butanoate (CAS 203805-93-0) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 234.31 g/mol. IUPAC name: (3R)-3-butanoyloxy-4-[dimethyl(trideuteriomethyl)azaniumyl]butanoate. InChIKey: QWYFHHGCZUCMBN-NNKNZJFPSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 234.31 g/mol |
| IUPAC name | (3R)-3-butanoyloxy-4-[dimethyl(trideuteriomethyl)azaniumyl]butanoate |
| InChIKey | QWYFHHGCZUCMBN-NNKNZJFPSA-N |
| SMILES | [2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)[O-])OC(=O)CCC |
Computed by PubChem (NCBI)