CAS 2043299-21-2 is the registry number for Antimicrobial agent-45. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(E)-2-(3,5-dimethoxy-4-methylphenyl)ethenyl]phenol (CAS 2043299-21-2) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: 4-[(E)-2-(3,5-dimethoxy-4-methylphenyl)ethenyl]phenol. InChIKey: YNJQKTOKBCBXJM-SNAWJCMRSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | 4-[(E)-2-(3,5-dimethoxy-4-methylphenyl)ethenyl]phenol |
| InChIKey | YNJQKTOKBCBXJM-SNAWJCMRSA-N |
| SMILES | CC1=C(C=C(C=C1OC)/C=C/C2=CC=C(C=C2)O)OC |
Computed by PubChem (NCBI)