Products 2044270-08-6
CAS 2044270-08-6 appears in our catalog under these names: 4,4'–(2,5–Dimethyl–1,4–phenylene)bis(1H–pyrazole), 4,4'-(2,5-Dimethyl-1,4-Phenylene)Bis(1H-Pyrazole), 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
4-[2,5-dimethyl-4-(1H-pyrazol-4-yl)phenyl]-1H-pyrazole (CAS 2044270-08-6) is a chemical compound with the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. IUPAC name: 4-[2,5-dimethyl-4-(1H-pyrazol-4-yl)phenyl]-1H-pyrazole. InChIKey: PHAARFVNNKNJOD-UHFFFAOYSA-N.
| Molecular formula | C14H14N4 |
|---|---|
| Molecular weight | 238.29 g/mol |
| IUPAC name | 4-[2,5-dimethyl-4-(1H-pyrazol-4-yl)phenyl]-1H-pyrazole |
| InChIKey | PHAARFVNNKNJOD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C2=CNN=C2)C)C3=CNN=C3 |
Computed by PubChem (NCBI)