Products 2044497-76-7

CAS 2044497-76-7 is the registry number for CGK012, 99.96%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 10mM/1mL, 25 mg.

Structural formula: {0} (CAS {1})

[(3S)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] N-cyclopentylcarbamate (CAS 2044497-76-7) is a chemical compound with the molecular formula C20H23NO5 and a molecular weight of 357.4 g/mol. IUPAC name: [(3S)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] N-cyclopentylcarbamate. InChIKey: JWNFWIWPOYKOSQ-KRWDZBQOSA-N.

Identity
Molecular formulaC20H23NO5
Molecular weight357.4 g/mol
IUPAC name[(3S)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] N-cyclopentylcarbamate
InChIKeyJWNFWIWPOYKOSQ-KRWDZBQOSA-N
SMILESCC1([C@H](CC2=C(O1)C=C3C(=C2)C=CC(=O)O3)OC(=O)NC4CCCC4)C

Computed by PubChem (NCBI)

Synonyms: orb2566618