Products 2044713-58-6
CAS 2044713-58-6 is the registry number for 2-(Dimethylamino)-3,4-difluorobenzaldehyde. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(dimethylamino)-3,4-difluorobenzaldehyde (CAS 2044713-58-6) is a chemical compound with the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. IUPAC name: 2-(dimethylamino)-3,4-difluorobenzaldehyde. InChIKey: HFFAYSLTRYEWHV-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO |
|---|---|
| Molecular weight | 185.17 g/mol |
| IUPAC name | 2-(dimethylamino)-3,4-difluorobenzaldehyde |
| InChIKey | HFFAYSLTRYEWHV-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=CC(=C1F)F)C=O |
Computed by PubChem (NCBI)