CAS 2044714-00-1 is the registry number for 2,4-Dioxo-1-(2-sulfanylethyl)-1,2,3,4-tetrahydropyrimidine-5-carbonitrile. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2,4-dioxo-1-(2-sulfanylethyl)pyrimidine-5-carbonitrile (CAS 2044714-00-1) is a chemical compound with the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. IUPAC name: 2,4-dioxo-1-(2-sulfanylethyl)pyrimidine-5-carbonitrile. InChIKey: PPZNYSXSRYXDPN-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2S |
|---|---|
| Molecular weight | 197.22 g/mol |
| IUPAC name | 2,4-dioxo-1-(2-sulfanylethyl)pyrimidine-5-carbonitrile |
| InChIKey | PPZNYSXSRYXDPN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1CCS)C#N |
Computed by PubChem (NCBI)