CAS 204771-74-4 appears in our catalog under these names: 2-Ethyl-5-nitro-1,3-benzoxazole, 95%, 2-Ethyl-5-nitrobenzo(d)oxazole, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g, 5g.
2-ethyl-5-nitro-1,3-benzoxazole (CAS 204771-74-4) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 2-ethyl-5-nitro-1,3-benzoxazole. InChIKey: FERFKXKLCUEJPW-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 2-ethyl-5-nitro-1,3-benzoxazole |
| InChIKey | FERFKXKLCUEJPW-UHFFFAOYSA-N |
| SMILES | CCC1=NC2=C(O1)C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)