Products 204783-05-1

CAS 204783-05-1 is the registry number for 3-Amino-4-methanesulfonylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

3-amino-4-methylsulfonylbenzoic acid (CAS 204783-05-1) is a chemical compound with the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. IUPAC name: 3-amino-4-methylsulfonylbenzoic acid. InChIKey: POFJHSYNRZHABR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO4S
Molecular weight215.23 g/mol
IUPAC name3-amino-4-methylsulfonylbenzoic acid
InChIKeyPOFJHSYNRZHABR-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=C(C=C(C=C1)C(=O)O)N

Computed by PubChem (NCBI)