CAS 204856-74-6 is the registry number for (S)–2–((tert–Butoxycarbonyl)amino)–3–(4–(methylsulfonamido)phenyl)propanoic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
3-[4-(methanesulfonamido)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 204856-74-6) is a chemical compound with the molecular formula C15H22N2O6S and a molecular weight of 358.4 g/mol. IUPAC name: 3-[4-(methanesulfonamido)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: KVAQHAYIHFSBMU-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O6S |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | 3-[4-(methanesulfonamido)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | KVAQHAYIHFSBMU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)NS(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)