Products 2089291-60-9
CAS 2089291-60-9 is the registry number for Methyl 2-(bis(tert-butoxycarbonyl)amino) thiazole-4-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-1,3-thiazole-4-carboxylate (CAS 2089291-60-9) is a chemical compound with the molecular formula C15H22N2O6S and a molecular weight of 358.4 g/mol. IUPAC name: methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-1,3-thiazole-4-carboxylate. InChIKey: XYOKEDNRCYKDFF-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O6S |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-1,3-thiazole-4-carboxylate |
| InChIKey | XYOKEDNRCYKDFF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=NC(=CS1)C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)