CAS 2720867-05-8 appears in our catalog under these names: Methyl (S)-2-amino-3-((S)-2-oxopyrrolidin-3-yl)propanoate 4-methylbenzenesulfonate, 98%, 98%, Methyl (S)-2-amino-3-((S)-2-oxopyrrolidin-3-yl)propanoate 4-methylbenzenesulfonate, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
Methyl (2S)-2-amino-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate;4-methylbenzenesulfonic acid (CAS 2720867-05-8) is a chemical compound with the molecular formula C15H22N2O6S and a molecular weight of 358.4 g/mol. IUPAC name: methyl (2S)-2-amino-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate;4-methylbenzenesulfonic acid. InChIKey: ADMIZMXZUOVJOC-GEMLJDPKSA-N.
| Molecular formula | C15H22N2O6S |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate;4-methylbenzenesulfonic acid |
| InChIKey | ADMIZMXZUOVJOC-GEMLJDPKSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.COC(=O)[C@H](C[C@@H]1CCNC1=O)N |
Computed by PubChem (NCBI)