Products 2439179-74-3
CAS 2439179-74-3 is the registry number for Anabolic agent-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[2-(dimethylamino)ethyl]-6-methoxy-1-benzofuran-2-carboxamide;methanesulfonic acid (CAS 2439179-74-3) is a chemical compound with the molecular formula C15H22N2O6S and a molecular weight of 358.4 g/mol. IUPAC name: N-[2-(dimethylamino)ethyl]-6-methoxy-1-benzofuran-2-carboxamide;methanesulfonic acid. InChIKey: QYDNZUNQDSSNPX-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O6S |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | N-[2-(dimethylamino)ethyl]-6-methoxy-1-benzofuran-2-carboxamide;methanesulfonic acid |
| InChIKey | QYDNZUNQDSSNPX-UHFFFAOYSA-N |
| SMILES | CN(C)CCNC(=O)C1=CC2=C(O1)C=C(C=C2)OC.CS(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Anabolic agent-1, orb1688720