Products 748777-71-1

CAS 748777-71-1 is the registry number for 4-Methoxy-3-{(3-(morpholin-4-yl)propyl)sulfamoyl}benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-methoxy-3-(3-morpholin-4-ylpropylsulfamoyl)benzoic acid (CAS 748777-71-1) is a chemical compound with the molecular formula C15H22N2O6S and a molecular weight of 358.4 g/mol. IUPAC name: 4-methoxy-3-(3-morpholin-4-ylpropylsulfamoyl)benzoic acid. InChIKey: ASEODXGAPXXLHA-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22N2O6S
Molecular weight358.4 g/mol
IUPAC name4-methoxy-3-(3-morpholin-4-ylpropylsulfamoyl)benzoic acid
InChIKeyASEODXGAPXXLHA-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C(=O)O)S(=O)(=O)NCCCN2CCOCC2

Computed by PubChem (NCBI)