CAS 2997-45-7 is the registry number for Dibenzo(b,e)fluoranthene. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg.
Hexacyclo[14.7.1.02,7.08,24.010,15.017,22]tetracosa-1(23),2,4,6,8,10,12,14,16(24),17,19,21-dodecaene (CAS 2997-45-7) is a chemical compound with the molecular formula C24H14 and a molecular weight of 302.4 g/mol. IUPAC name: hexacyclo[14.7.1.02,7.08,24.010,15.017,22]tetracosa-1(23),2,4,6,8,10,12,14,16(24),17,19,21-dodecaene. InChIKey: OVYNMPKAJJJORA-UHFFFAOYSA-N.
| Molecular formula | C24H14 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | hexacyclo[14.7.1.02,7.08,24.010,15.017,22]tetracosa-1(23),2,4,6,8,10,12,14,16(24),17,19,21-dodecaene |
| InChIKey | OVYNMPKAJJJORA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C4=CC=CC=C4C5=CC6=CC=CC=C6C2=C35 |
Computed by PubChem (NCBI)