Products 5385-22-8
CAS 5385-22-8 is the registry number for Dibenzo(b,j)fluoranthene. Offered by: TRC. Available pack sizes: 100mg.
Hexacyclo[11.10.1.03,8.09,24.014,23.015,20]tetracosa-1,3,5,7,9(24),10,12,14(23),15,17,19,21-dodecaene (CAS 5385-22-8) is a chemical compound with the molecular formula C24H14 and a molecular weight of 302.4 g/mol. IUPAC name: hexacyclo[11.10.1.03,8.09,24.014,23.015,20]tetracosa-1,3,5,7,9(24),10,12,14(23),15,17,19,21-dodecaene. InChIKey: YDGLBVYJRMXXCW-UHFFFAOYSA-N.
| Molecular formula | C24H14 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | hexacyclo[11.10.1.03,8.09,24.014,23.015,20]tetracosa-1,3,5,7,9(24),10,12,14(23),15,17,19,21-dodecaene |
| InChIKey | YDGLBVYJRMXXCW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=CC=CC5=C4C3=CC6=CC=CC=C56 |
Computed by PubChem (NCBI)