CAS 20532-45-0 is the registry number for N,N-Dimethyl-5-nitro-1-benzothiophene-2-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N,N-dimethyl-5-nitro-1-benzothiophene-2-carboxamide (CAS 20532-45-0) is a chemical compound with the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. IUPAC name: N,N-dimethyl-5-nitro-1-benzothiophene-2-carboxamide. InChIKey: ZUEMKGSVVSOTDZ-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3S |
|---|---|
| Molecular weight | 250.28 g/mol |
| IUPAC name | N,N-dimethyl-5-nitro-1-benzothiophene-2-carboxamide |
| InChIKey | ZUEMKGSVVSOTDZ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC2=C(S1)C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)