CAS 175453-08-4 appears in our catalog under these names: Fmoc–Phe(4–Cl)–OH, Fmoc-Phe(4-Cl)-OH, Fmoc-4-Chloro-phenylalanine, 97%, Fmoc-L-Phe(4-Cl)-OH, Fmoc-Phe(4-Cl)-OH 97%. Offered by: GLPBio, TargetMol, Fluorochem, Iris Biotech, Ambeed. Available pack sizes: 100g, 25g, 50mg, 100mg, 1g, 5g, 10g, 500g.
(2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 175453-08-4) is a chemical compound with the molecular formula C24H20ClNO4 and a molecular weight of 421.9 g/mol. IUPAC name: (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: CQPNKLNINBUUOM-QFIPXVFZSA-N.
| Molecular formula | C24H20ClNO4 |
|---|---|
| Molecular weight | 421.9 g/mol |
| IUPAC name | (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | CQPNKLNINBUUOM-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)Cl)C(=O)O |
Computed by PubChem (NCBI)