Products 2055713-74-9
CAS 2055713-74-9 appears in our catalog under these names: 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[d]oxazole, 98%, 1,3-Benzoxazole-4-boronic acid pinacol ester, 98%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole (CAS 2055713-74-9) is a chemical compound with the molecular formula C13H16BNO3 and a molecular weight of 245.08 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole. InChIKey: SKCMIHMRZQVFKC-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO3 |
|---|---|
| Molecular weight | 245.08 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole |
| InChIKey | SKCMIHMRZQVFKC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)OC=N3 |
Computed by PubChem (NCBI)