CAS 2055848-84-3 appears in our catalog under these names: (1R)-5-Chloro-1,2,3,4-tetrahydronaphthylamine hydrochloride, 95%, (R)-5-Chloro-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%, 95%, (R)-5-Chloro-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 250mg, 50mg, 100mg, 1g.
(1R)-5-chloro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 2055848-84-3) is a chemical compound with the molecular formula C10H13Cl2N and a molecular weight of 218.12 g/mol. IUPAC name: (1R)-5-chloro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: ROFGJRAIZDETPN-HNCPQSOCSA-N.
| Molecular formula | C10H13Cl2N |
|---|---|
| Molecular weight | 218.12 g/mol |
| IUPAC name | (1R)-5-chloro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | ROFGJRAIZDETPN-HNCPQSOCSA-N |
| SMILES | C1C[C@H](C2=C(C1)C(=CC=C2)Cl)N.Cl |
Computed by PubChem (NCBI)