CAS 2055848-92-3 appears in our catalog under these names: (S)-5-Chloro-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 97%, (1S)-5-chloro-1,2,3,4-tetrahydronaphthylamine hydrochloride, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
(1S)-5-chloro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 2055848-92-3) is a chemical compound with the molecular formula C10H13Cl2N and a molecular weight of 218.12 g/mol. IUPAC name: (1S)-5-chloro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: ROFGJRAIZDETPN-PPHPATTJSA-N.
| Molecular formula | C10H13Cl2N |
|---|---|
| Molecular weight | 218.12 g/mol |
| IUPAC name | (1S)-5-chloro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | ROFGJRAIZDETPN-PPHPATTJSA-N |
| SMILES | C1C[C@@H](C2=C(C1)C(=CC=C2)Cl)N.Cl |
Computed by PubChem (NCBI)