Products 2055882-23-8
CAS 2055882-23-8 appears in our catalog under these names: Pterocarpadiol D, Pterocarpadiol D. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
(6aS,11aR,11bS)-6a,11b-dihydroxy-9-methoxy-1,2,6,11a-tetrahydro-[1]benzofuro[3,2-c]chromen-3-one (CAS 2055882-23-8) is a chemical compound with the molecular formula C16H16O6 and a molecular weight of 304.29 g/mol. IUPAC name: (6aS,11aR,11bS)-6a,11b-dihydroxy-9-methoxy-1,2,6,11a-tetrahydro-[1]benzofuro[3,2-c]chromen-3-one. InChIKey: KWUKOIDTQSGINV-ARFHVFGLSA-N.
| Molecular formula | C16H16O6 |
|---|---|
| Molecular weight | 304.29 g/mol |
| IUPAC name | (6aS,11aR,11bS)-6a,11b-dihydroxy-9-methoxy-1,2,6,11a-tetrahydro-[1]benzofuro[3,2-c]chromen-3-one |
| InChIKey | KWUKOIDTQSGINV-ARFHVFGLSA-N |
| SMILES | COC1=CC2=C(C=C1)[C@@]3(COC4=CC(=O)CC[C@@]4([C@@H]3O2)O)O |
Computed by PubChem (NCBI)
Synonyms:
Pterocarpadiol D, orb1681834