CAS 205746-51-6 is the registry number for 1-(2,2-Dibromovinyl)-3,5-dimethoxybenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,2-dibromoethenyl)-3,5-dimethoxybenzene (CAS 205746-51-6) is a chemical compound with the molecular formula C10H10Br2O2 and a molecular weight of 321.99 g/mol. IUPAC name: 1-(2,2-dibromoethenyl)-3,5-dimethoxybenzene. InChIKey: DEHUEXAOTYHVOQ-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O2 |
|---|---|
| Molecular weight | 321.99 g/mol |
| IUPAC name | 1-(2,2-dibromoethenyl)-3,5-dimethoxybenzene |
| InChIKey | DEHUEXAOTYHVOQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C=C(Br)Br)OC |
Computed by PubChem (NCBI)