Products 20595-49-7
CAS 20595-49-7 appears in our catalog under these names: (E)-3-(2,6-Dichlorophenyl)acrylic acid, 98%, 98%, (E)-3-(2,6-Dichlorophenyl)acrylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g.
(E)-3-(2,6-dichlorophenyl)prop-2-enoic acid (CAS 20595-49-7) is a chemical compound with the molecular formula C9H6Cl2O2 and a molecular weight of 217.05 g/mol. IUPAC name: (E)-3-(2,6-dichlorophenyl)prop-2-enoic acid. InChIKey: OIPVGRCXMFBNAN-SNAWJCMRSA-N.
| Molecular formula | C9H6Cl2O2 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | (E)-3-(2,6-dichlorophenyl)prop-2-enoic acid |
| InChIKey | OIPVGRCXMFBNAN-SNAWJCMRSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)/C=C/C(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,6-Dichlorocinnamic acid, 3-(2,6-Dichlorophenyl)acrylic acid, (E)-3-(2,6-Dichlorophenyl)acrylic acid, 2,6-Dichlorocinnamic Acid, Predominantly Trans, 2,6-Dichloro-trans-cinnamic acid, (2E)-3-(2,6-dichlorophenyl)prop-2-enoic acid, 2-propenoic acid, 3-(2,6-dichlorophenyl)-, (2E)-, (E)-3-(2,6-dichlorophenyl)prop-2-enoic acid, 2-Propenoic acid, 3-(2,6-dichlorophenyl)-, 3-(2,6-dichlorophenyl)prop-2-enoic acid