Products 386715-49-7
CAS 386715-49-7 appears in our catalog under these names: 1-(3,5-Dichlorophenyl)-1,2-propandione, 95%, 1-(3,5-Dichlorophenyl)propane-1,2-dione. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 25g.
1-(3,5-dichlorophenyl)propane-1,2-dione (CAS 386715-49-7) is a chemical compound with the molecular formula C9H6Cl2O2 and a molecular weight of 217.05 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)propane-1,2-dione. InChIKey: WWMMJQWHEMLODX-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O2 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)propane-1,2-dione |
| InChIKey | WWMMJQWHEMLODX-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=O)C1=CC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)