CAS 849936-29-4 appears in our catalog under these names: 2-(3,4-Dichlorophenyl)malondialdehyde, 95%, 2-(3,4-Dichlorophenyl)malondialdehyde. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 10g.
2-(3,4-dichlorophenyl)propanedial (CAS 849936-29-4) is a chemical compound with the molecular formula C9H6Cl2O2 and a molecular weight of 217.05 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)propanedial. InChIKey: FFKPYMPSYNYNAX-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O2 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)propanedial |
| InChIKey | FFKPYMPSYNYNAX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C=O)C=O)Cl)Cl |
Computed by PubChem (NCBI)