CAS 34164-42-6 appears in our catalog under these names: 2,3-Dichlorocinnamic acid, 98%, 2-Propenoic acid, 3-(2,3-dichlorophenyl)-, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 10g, 25g, 1g, 5g, 100g, on request.
(E)-3-(2,3-dichlorophenyl)prop-2-enoic acid (CAS 34164-42-6) is a chemical compound with the molecular formula C9H6Cl2O2 and a molecular weight of 217.05 g/mol. IUPAC name: (E)-3-(2,3-dichlorophenyl)prop-2-enoic acid. InChIKey: RCEWIEGWGDHVNK-SNAWJCMRSA-N.
| Molecular formula | C9H6Cl2O2 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | (E)-3-(2,3-dichlorophenyl)prop-2-enoic acid |
| InChIKey | RCEWIEGWGDHVNK-SNAWJCMRSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)/C=C/C(=O)O |
Computed by PubChem (NCBI)