Products 916792-25-1
CAS 916792-25-1 is the registry number for 6,8-Dichlorochroman-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-dichloro-3,4-dihydrochromen-2-one (CAS 916792-25-1) is a chemical compound with the molecular formula C9H6Cl2O2 and a molecular weight of 217.05 g/mol. IUPAC name: 6,8-dichloro-3,4-dihydrochromen-2-one. InChIKey: DNRWXABMOCRPIA-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O2 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 6,8-dichloro-3,4-dihydrochromen-2-one |
| InChIKey | DNRWXABMOCRPIA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)OC2=C1C=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)