CAS 205985-97-3 appears in our catalog under these names: Methyl 5-bromonicotinoylacetate, 98%, Methyl 5-bromonicotinoylacetate, 95%, 95%, Methyl 5-bromonicotinoylacetate, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
Methyl 3-(5-bromo-3-pyridinyl)-3-oxopropanoate (CAS 205985-97-3) is a chemical compound with the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. IUPAC name: methyl 3-(5-bromo-3-pyridinyl)-3-oxopropanoate. InChIKey: YVDRZMXIMURBFZ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO3 |
|---|---|
| Molecular weight | 258.07 g/mol |
| IUPAC name | methyl 3-(5-bromo-3-pyridinyl)-3-oxopropanoate |
| InChIKey | YVDRZMXIMURBFZ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)C1=CC(=CN=C1)Br |
Computed by PubChem (NCBI)