Products 2059917-87-0
CAS 2059917-87-0 appears in our catalog under these names: trans–methyl 4–phenylpyrrolidine–3–carboxylate hydrochloride, Rac-methyl (3R,4S)-4-phenylpyrrolidine-3-carboxylate hydrochloride, 90%, 90%, Methyl (3S,4R)-4-phenylpyrrolidine-3-carboxylate hydrochloride, 90%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
Methyl (3S,4R)-4-phenylpyrrolidine-3-carboxylate;hydrochloride (CAS 2059917-87-0) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: methyl (3S,4R)-4-phenylpyrrolidine-3-carboxylate;hydrochloride. InChIKey: LBUJDEHQFGPGOH-VZXYPILPSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | methyl (3S,4R)-4-phenylpyrrolidine-3-carboxylate;hydrochloride |
| InChIKey | LBUJDEHQFGPGOH-VZXYPILPSA-N |
| SMILES | COC(=O)[C@@H]1CNC[C@H]1C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)