CAS 874367-19-8 is the registry number for rac-methyl (3R,4S)-4-phenylpyrrolidine-3-carboxylate hydrochloride, trans. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
Methyl (3R,4S)-4-phenylpyrrolidine-3-carboxylate;hydrochloride (CAS 874367-19-8) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: methyl (3R,4S)-4-phenylpyrrolidine-3-carboxylate;hydrochloride. InChIKey: LBUJDEHQFGPGOH-DHXVBOOMSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | methyl (3R,4S)-4-phenylpyrrolidine-3-carboxylate;hydrochloride |
| InChIKey | LBUJDEHQFGPGOH-DHXVBOOMSA-N |
| SMILES | COC(=O)[C@H]1CNC[C@@H]1C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)